C26H27N3O2 — CID 90964746
9-[8-(furan-3-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]-9H-xanthene-3-carboximidamide (PubChem CID 90964746) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 9-[8-(furan-3-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]-9H-xanthene-3-carboximidamide.
| Compound Name | 9-[8-(furan-3-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]-9H-xanthene-3-carboximidamide |
|---|---|
| PubChem CID | 90964746 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 9-[8-(furan-3-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]-9H-xanthene-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)Oc1ccccc1C2C1CC2CCC(C1)N2Cc1ccoc1 |
| InChI | InChI=1S/C26H27N3O2/c27-26(28)17-5-8-22-24(13-17)31-23-4-2-1-3-21(23)25(22)18-11-19-6-7-20(12-18)29(19)14-16-9-10-30-15-16/h1-5,8-10,13,15,18-20,25H,6-7,11-12,14H2,(H3,27,28) |
| InChIKey | GYPUIFFLFXLMON-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|