C28H32N2O3 — CID 11655206
N,N-diethyl-9-[1-(furan-3-ylmethyl)piperidin-4-yl]-9H-xanthene-3-carboxamide (PubChem CID 11655206) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is N,N-diethyl-9-[1-(furan-3-ylmethyl)piperidin-4-yl]-9H-xanthene-3-carboxamide.
| Compound Name | N,N-diethyl-9-[1-(furan-3-ylmethyl)piperidin-4-yl]-9H-xanthene-3-carboxamide |
|---|---|
| PubChem CID | 11655206 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | N,N-diethyl-9-[1-(furan-3-ylmethyl)piperidin-4-yl]-9H-xanthene-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc2c(c1)Oc1ccccc1C2C1CCN(Cc2ccoc2)CC1 |
| InChI | InChI=1S/C28H32N2O3/c1-3-30(4-2)28(31)22-9-10-24-26(17-22)33-25-8-6-5-7-23(25)27(24)21-11-14-29(15-12-21)18-20-13-16-32-19-20/h5-10,13,16-17,19,21,27H,3-4,11-12,14-15,18H2,1-2H3 |
| InChIKey | QRAXHWOROHLJLS-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |