C22H36FN — CID 141149170
8-[(2S)-3-[(1R)-3-fluorocyclohexa-2,4-dien-1-yl]-2-methylpropyl]-3-pentyl-8-azabicyclo[3.2.1]octane (PubChem CID 141149170) has the molecular formula C22H36FN and a molecular weight of 333.54 g/mol. Its IUPAC name is 8-[(2S)-3-[(1R)-3-fluorocyclohexa-2,4-dien-1-yl]-2-methylpropyl]-3-pentyl-8-azabicyclo[3.2.1]octane.
| Compound Name | 8-[(2S)-3-[(1R)-3-fluorocyclohexa-2,4-dien-1-yl]-2-methylpropyl]-3-pentyl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 141149170 |
| Molecular Formula | C22H36FN |
| Molecular Weight | 333.54 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | 8-[(2S)-3-[(1R)-3-fluorocyclohexa-2,4-dien-1-yl]-2-methylpropyl]-3-pentyl-8-azabicyclo[3.2.1]octane |
| SMILES | CCCCCC1CC2CCC(C1)N2C[C@@H](C)C[C@@H]1C=C(F)C=CC1 |
| InChI | InChI=1S/C22H36FN/c1-3-4-5-7-19-14-21-10-11-22(15-19)24(21)16-17(2)12-18-8-6-9-20(23)13-18/h6,9,13,17-19,21-22H,3-5,7-8,10-12,14-16H2,1-2H3/t17-,18+,19?,21?,22?/m0/s1 |
| InChIKey | HHPNRUPTUUHSEE-KDEINVLHSA-N |
| XLogP | 6.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|