C18H20O5 — CID 141151440
[2-ethenyl-6-(2,3,4-trimethoxyphenyl)phenoxy]methanol (PubChem CID 141151440) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is [2-ethenyl-6-(2,3,4-trimethoxyphenyl)phenoxy]methanol.
| Compound Name | [2-ethenyl-6-(2,3,4-trimethoxyphenyl)phenoxy]methanol |
|---|---|
| PubChem CID | 141151440 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | [2-ethenyl-6-(2,3,4-trimethoxyphenyl)phenoxy]methanol |
| SMILES | C=Cc1cccc(-c2ccc(OC)c(OC)c2OC)c1OCO |
| InChI | InChI=1S/C18H20O5/c1-5-12-7-6-8-13(16(12)23-11-19)14-9-10-15(20-2)18(22-4)17(14)21-3/h5-10,19H,1,11H2,2-4H3 |
| InChIKey | OYXRGFZETXPAFA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|