C15H25N5O3 — CID 141152832
4-[4-(hydroxyamino)-4-oxobutyl]-N-(2H-pyrimidin-1-ylmethyl)piperidine-1-carboxamide (PubChem CID 141152832) has the molecular formula C15H25N5O3 and a molecular weight of 323.40 g/mol. Its IUPAC name is 4-[4-(hydroxyamino)-4-oxobutyl]-N-(2H-pyrimidin-1-ylmethyl)piperidine-1-carboxamide.
| Compound Name | 4-[4-(hydroxyamino)-4-oxobutyl]-N-(2H-pyrimidin-1-ylmethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 141152832 |
| Molecular Formula | C15H25N5O3 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 4-[4-(hydroxyamino)-4-oxobutyl]-N-(2H-pyrimidin-1-ylmethyl)piperidine-1-carboxamide |
| SMILES | O=C(CCCC1CCN(C(=O)NCN2C=CC=NC2)CC1)NO |
| InChI | InChI=1S/C15H25N5O3/c21-14(18-23)4-1-3-13-5-9-20(10-6-13)15(22)17-12-19-8-2-7-16-11-19/h2,7-8,13,23H,1,3-6,9-12H2,(H,17,22)(H,18,21) |
| InChIKey | NZDLJMMPPWHKCK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|