C20H27P — CID 141152904
(2S,5S)-2,5-dimethyl-1-[(1Z,7Z)-2-phenylcycloocta-1,7-dien-1-yl]phospholane (PubChem CID 141152904) has the molecular formula C20H27P and a molecular weight of 298.41 g/mol. Its IUPAC name is (2S,5S)-2,5-dimethyl-1-[(1Z,7Z)-2-phenylcycloocta-1,7-dien-1-yl]phospholane.
| Compound Name | (2S,5S)-2,5-dimethyl-1-[(1Z,7Z)-2-phenylcycloocta-1,7-dien-1-yl]phospholane |
|---|---|
| PubChem CID | 141152904 |
| Molecular Formula | C20H27P |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (2S,5S)-2,5-dimethyl-1-[(1Z,7Z)-2-phenylcycloocta-1,7-dien-1-yl]phospholane |
| SMILES | C[C@H]1CC[C@H](C)P1C1=C(\c2ccccc2)CCCC/C=C\1 |
| InChI | InChI=1S/C20H27P/c1-16-14-15-17(2)21(16)20-13-9-4-3-8-12-19(20)18-10-6-5-7-11-18/h5-7,9-11,13,16-17H,3-4,8,12,14-15H2,1-2H3/b13-9-,20-19-/t16-,17-/m0/s1 |
| InChIKey | HPHHZKWGTIYIGU-NEGJNYGCSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|