C10H20F2O6P2 — CID 14115302
(Z)-1,2-bis(diethoxyphosphoryl)-1,2-difluoroethene (PubChem CID 14115302) has the molecular formula C10H20F2O6P2 and a molecular weight of 336.21 g/mol. Its IUPAC name is (Z)-1,2-bis(diethoxyphosphoryl)-1,2-difluoroethene.
| Compound Name | (Z)-1,2-bis(diethoxyphosphoryl)-1,2-difluoroethene |
|---|---|
| PubChem CID | 14115302 |
| Molecular Formula | C10H20F2O6P2 |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | (Z)-1,2-bis(diethoxyphosphoryl)-1,2-difluoroethene |
| SMILES | CCOP(=O)(OCC)/C(F)=C(/F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C10H20F2O6P2/c1-5-15-19(13,16-6-2)9(11)10(12)20(14,17-7-3)18-8-4/h5-8H2,1-4H3/b10-9- |
| InChIKey | KBAKOABLJFQWME-KTKRTIGZSA-N |
| XLogP | 4.58 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|