C17H15NO7 — CID 141156033
[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]methanetricarboxylic acid (PubChem CID 141156033) has the molecular formula C17H15NO7 and a molecular weight of 345.31 g/mol. Its IUPAC name is [1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]methanetricarboxylic acid.
| Compound Name | [1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]methanetricarboxylic acid |
|---|---|
| PubChem CID | 141156033 |
| Molecular Formula | C17H15NO7 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | [1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]methanetricarboxylic acid |
| SMILES | Cc1ccc(C(=O)c2ccc(C(C(=O)O)(C(=O)O)C(=O)O)n2C)cc1 |
| InChI | InChI=1S/C17H15NO7/c1-9-3-5-10(6-4-9)13(19)11-7-8-12(18(11)2)17(14(20)21,15(22)23)16(24)25/h3-8H,1-2H3,(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | OVMLDBZRIOQQFB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 133.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|