C17H22N2O3 — CID 171511988
amino 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate;ethane (PubChem CID 171511988) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is amino 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate;ethane.
| Compound Name | amino 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate;ethane |
|---|---|
| PubChem CID | 171511988 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | amino 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate;ethane |
| SMILES | CC.Cc1ccc(C(=O)c2ccc(CC(=O)ON)n2C)cc1 |
| InChI | InChI=1S/C15H16N2O3.C2H6/c1-10-3-5-11(6-4-10)15(19)13-8-7-12(17(13)2)9-14(18)20-16;1-2/h3-8H,9,16H2,1-2H3;1-2H3 |
| InChIKey | DMDTVBSXKBZQBL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|