C21H29N3O5 — CID 70449139
(2S)-6-amino-2-[[2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetyl]amino]hexanoic acid;hydrate (PubChem CID 70449139) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is (2S)-6-amino-2-[[2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetyl]amino]hexanoic acid;hydrate.
| Compound Name | (2S)-6-amino-2-[[2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetyl]amino]hexanoic acid;hydrate |
|---|---|
| PubChem CID | 70449139 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (2S)-6-amino-2-[[2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetyl]amino]hexanoic acid;hydrate |
| SMILES | Cc1ccc(C(=O)c2ccc(CC(=O)N[C@@H](CCCCN)C(=O)O)n2C)cc1.O |
| InChI | InChI=1S/C21H27N3O4.H2O/c1-14-6-8-15(9-7-14)20(26)18-11-10-16(24(18)2)13-19(25)23-17(21(27)28)5-3-4-12-22;/h6-11,17H,3-5,12-13,22H2,1-2H3,(H,23,25)(H,27,28);1H2/t17-;/m0./s1 |
| InChIKey | PFBSHZPJSJMRJW-LMOVPXPDSA-N |
| XLogP | 0.98 |
| TPSA | 145.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|