C21H29ClN2O3 — CID 67460465
2-(diethylamino)ethyl 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate;hydrochloride (PubChem CID 67460465) has the molecular formula C21H29ClN2O3 and a molecular weight of 392.93 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate;hydrochloride.
| Compound Name | 2-(diethylamino)ethyl 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 67460465 |
| Molecular Formula | C21H29ClN2O3 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 2-(diethylamino)ethyl 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate;hydrochloride |
| SMILES | CCN(CC)CCOC(=O)Cc1ccc(C(=O)c2ccc(C)cc2)n1C.Cl |
| InChI | InChI=1S/C21H28N2O3.ClH/c1-5-23(6-2)13-14-26-20(24)15-18-11-12-19(22(18)4)21(25)17-9-7-16(3)8-10-17;/h7-12H,5-6,13-15H2,1-4H3;1H |
| InChIKey | NSSREEROJHDFKR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |