C21H21BrN2O3S — CID 70100389
N-[3-bromo-4-[[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]methyl]phenyl]methanesulfonamide (PubChem CID 70100389) has the molecular formula C21H21BrN2O3S and a molecular weight of 461.38 g/mol. Its IUPAC name is N-[3-bromo-4-[[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]methyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-bromo-4-[[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 70100389 |
| Molecular Formula | C21H21BrN2O3S |
| Molecular Weight | 461.38 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | N-[3-bromo-4-[[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]methyl]phenyl]methanesulfonamide |
| SMILES | Cc1ccc(C(=O)c2ccc(Cc3ccc(NS(C)(=O)=O)cc3Br)n2C)cc1 |
| InChI | InChI=1S/C21H21BrN2O3S/c1-14-4-6-15(7-5-14)21(25)20-11-10-18(24(20)2)12-16-8-9-17(13-19(16)22)23-28(3,26)27/h4-11,13,23H,12H2,1-3H3 |
| InChIKey | YMTMTMIUHNBLNH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |