About (5-butyl-2-phenylphenyl) 4-octoxy-3-prop-2-enoxybenzoate
(5-butyl-2-phenylphenyl) 4-octoxy-3-prop-2-enoxybenzoate (PubChem CID 141156522) has the molecular formula C34H42O4
and a molecular weight of 514.71 g/mol. Its IUPAC name is (5-butyl-2-phenylphenyl) 4-octoxy-3-prop-2-enoxybenzoate.
Molecular Properties
| Compound Name | (5-butyl-2-phenylphenyl) 4-octoxy-3-prop-2-enoxybenzoate |
| PubChem CID | 141156522 |
| Molecular Formula | C34H42O4 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | (5-butyl-2-phenylphenyl) 4-octoxy-3-prop-2-enoxybenzoate |
| SMILES | C=CCOc1cc(C(=O)Oc2cc(CCCC)ccc2-c2ccccc2)ccc1OCCCCCCCC |
| InChI | InChI=1S/C34H42O4/c1-4-7-9-10-11-15-24-37-31-22-20-29(26-33(31)36-23-6-3)34(35)38-32-25-27(16-8-5-2)19-21-30(32)28-17-13-12-14-18-28/h6,12-14,17-22,25-26H,3-5,7-11,15-16,23-24H2,1-2H3 |
| InChIKey | MXHGPCNPFTWQBJ-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (5-butyl-2-phenylphenyl) 4-octoxy-3-prop-2-enoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-butyl-2-phenylphenyl) 4-octoxy-3-prop-2-enoxybenzoate?
The IUPAC name of (5-butyl-2-phenylphenyl) 4-octoxy-3-prop-2-enoxybenzoate (CID 141156522) is (5-butyl-2-phenylphenyl) 4-octoxy-3-prop-2-enoxybenzoate.
What is the SMILES notation for (5-butyl-2-phenylphenyl) 4-octoxy-3-prop-2-enoxybenzoate?
The canonical SMILES for (5-butyl-2-phenylphenyl) 4-octoxy-3-prop-2-enoxybenzoate is C=CCOc1cc(C(=O)Oc2cc(CCCC)ccc2-c2ccccc2)ccc1OCCCCCCCC.
What is the InChIKey of (5-butyl-2-phenylphenyl) 4-octoxy-3-prop-2-enoxybenzoate?
The InChIKey is MXHGPCNPFTWQBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H42O4/c1-4-7-9-10-11-15-24-37-31-22-20-29(26-33(31)36-23-6-3)34(35)38-32-25-27(16-8-5-2)19-21-30(32)28-17-13-12-14-18-28/h6,12-14,17-22,25-26H,3-5,7-11,15-16,23-24H2,1-2H3.
What are the key properties of (5-butyl-2-phenylphenyl) 4-octoxy-3-prop-2-enoxybenzoate?
(5-butyl-2-phenylphenyl) 4-octoxy-3-prop-2-enoxybenzoate has a molecular weight of 514.71 g/mol, XLogP of 9.22, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-butyl-2-phenylphenyl) 4-octoxy-3-prop-2-enoxybenzoate is sourced from PubChem (CID 141156522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).