C22H22N4O2S2 — CID 141158016
1-[(5-anilino-3-oxo-5-sulfanylpentanoyl)amino]-3-naphthalen-1-ylthiourea (PubChem CID 141158016) has the molecular formula C22H22N4O2S2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 1-[(5-anilino-3-oxo-5-sulfanylpentanoyl)amino]-3-naphthalen-1-ylthiourea.
| Compound Name | 1-[(5-anilino-3-oxo-5-sulfanylpentanoyl)amino]-3-naphthalen-1-ylthiourea |
|---|---|
| PubChem CID | 141158016 |
| Molecular Formula | C22H22N4O2S2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 1-[(5-anilino-3-oxo-5-sulfanylpentanoyl)amino]-3-naphthalen-1-ylthiourea |
| SMILES | O=C(CC(=O)NNC(=S)Nc1cccc2ccccc12)CC(S)Nc1ccccc1 |
| InChI | InChI=1S/C22H22N4O2S2/c27-17(14-21(29)23-16-9-2-1-3-10-16)13-20(28)25-26-22(30)24-19-12-6-8-15-7-4-5-11-18(15)19/h1-12,21,23,29H,13-14H2,(H,25,28)(H2,24,26,30) |
| InChIKey | DDXYEKOCXBCGMS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|