C26H31N5O6 — CID 141158654
tert-butyl N-[dimethoxy(phenyl)methyl]-N-[5-nitro-6-(1-pyridin-3-ylethylamino)-2-pyridinyl]carbamate (PubChem CID 141158654) has the molecular formula C26H31N5O6 and a molecular weight of 509.56 g/mol. Its IUPAC name is tert-butyl N-[dimethoxy(phenyl)methyl]-N-[5-nitro-6-(1-pyridin-3-ylethylamino)-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[dimethoxy(phenyl)methyl]-N-[5-nitro-6-(1-pyridin-3-ylethylamino)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 141158654 |
| Molecular Formula | C26H31N5O6 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | tert-butyl N-[dimethoxy(phenyl)methyl]-N-[5-nitro-6-(1-pyridin-3-ylethylamino)-2-pyridinyl]carbamate |
| SMILES | COC(OC)(c1ccccc1)N(C(=O)OC(C)(C)C)c1ccc([N+](=O)[O-])c(NC(C)c2cccnc2)n1 |
| InChI | InChI=1S/C26H31N5O6/c1-18(19-11-10-16-27-17-19)28-23-21(31(33)34)14-15-22(29-23)30(24(32)37-25(2,3)4)26(35-5,36-6)20-12-8-7-9-13-20/h7-18H,1-6H3,(H,28,29) |
| InChIKey | MUJJLGLGXUQLMK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 128.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|