C18H22N2 — CID 141160011
3-N-(2,2-dimethyl-1,3-dihydroinden-5-yl)-4-methylbenzene-1,3-diamine (PubChem CID 141160011) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 3-N-(2,2-dimethyl-1,3-dihydroinden-5-yl)-4-methylbenzene-1,3-diamine.
| Compound Name | 3-N-(2,2-dimethyl-1,3-dihydroinden-5-yl)-4-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 141160011 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 3-N-(2,2-dimethyl-1,3-dihydroinden-5-yl)-4-methylbenzene-1,3-diamine |
| SMILES | Cc1ccc(N)cc1Nc1ccc2c(c1)CC(C)(C)C2 |
| InChI | InChI=1S/C18H22N2/c1-12-4-6-15(19)9-17(12)20-16-7-5-13-10-18(2,3)11-14(13)8-16/h4-9,20H,10-11,19H2,1-3H3 |
| InChIKey | NSJXNESTGVUSPC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|