C11H20O7 — CID 141161997
1-deuterio-2-[(3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-2,3,4-trihydroxyoxolan-2-yl]pentan-1-one (PubChem CID 141161997) has the molecular formula C11H20O7 and a molecular weight of 265.28 g/mol. Its IUPAC name is 1-deuterio-2-[(3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-2,3,4-trihydroxyoxolan-2-yl]pentan-1-one.
| Compound Name | 1-deuterio-2-[(3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-2,3,4-trihydroxyoxolan-2-yl]pentan-1-one |
|---|---|
| PubChem CID | 141161997 |
| Molecular Formula | C11H20O7 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-deuterio-2-[(3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-2,3,4-trihydroxyoxolan-2-yl]pentan-1-one |
| SMILES | [2H]C(=O)C(CCC)C1(O)O[C@@H]([C@H](O)CO)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H20O7/c1-2-3-6(4-12)11(17)10(16)8(15)9(18-11)7(14)5-13/h4,6-10,13-17H,2-3,5H2,1H3/t6?,7-,8+,9+,10-,11?/m1/s1/i4D |
| InChIKey | DOOANPLTNHWCJI-KNUJRJETSA-N |
| XLogP | -2.24 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|