C16H17ClFN3S2 — CID 141164778
2-[3-[chloro(fluoro)methyl]sulfanylphenyl]-1-methyl-1-(3-methylsulfanylphenyl)guanidine (PubChem CID 141164778) has the molecular formula C16H17ClFN3S2 and a molecular weight of 369.92 g/mol. Its IUPAC name is 2-[3-[chloro(fluoro)methyl]sulfanylphenyl]-1-methyl-1-(3-methylsulfanylphenyl)guanidine.
| Compound Name | 2-[3-[chloro(fluoro)methyl]sulfanylphenyl]-1-methyl-1-(3-methylsulfanylphenyl)guanidine |
|---|---|
| PubChem CID | 141164778 |
| Molecular Formula | C16H17ClFN3S2 |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 2-[3-[chloro(fluoro)methyl]sulfanylphenyl]-1-methyl-1-(3-methylsulfanylphenyl)guanidine |
| SMILES | CSc1cccc(N(C)/C(N)=N/c2cccc(SC(F)Cl)c2)c1 |
| InChI | InChI=1S/C16H17ClFN3S2/c1-21(12-6-4-7-13(10-12)22-2)16(19)20-11-5-3-8-14(9-11)23-15(17)18/h3-10,15H,1-2H3,(H2,19,20) |
| InChIKey | QNTMLJFCXCIVQO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|