C17H20BrN3S — CID 174348466
2-(2-bromo-2-phenylethyl)-1-methyl-1-(3-methylsulfanylphenyl)guanidine (PubChem CID 174348466) has the molecular formula C17H20BrN3S and a molecular weight of 378.34 g/mol. Its IUPAC name is 2-(2-bromo-2-phenylethyl)-1-methyl-1-(3-methylsulfanylphenyl)guanidine.
| Compound Name | 2-(2-bromo-2-phenylethyl)-1-methyl-1-(3-methylsulfanylphenyl)guanidine |
|---|---|
| PubChem CID | 174348466 |
| Molecular Formula | C17H20BrN3S |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 2-(2-bromo-2-phenylethyl)-1-methyl-1-(3-methylsulfanylphenyl)guanidine |
| SMILES | CSc1cccc(N(C)/C(N)=N/CC(Br)c2ccccc2)c1 |
| InChI | InChI=1S/C17H20BrN3S/c1-21(14-9-6-10-15(11-14)22-2)17(19)20-12-16(18)13-7-4-3-5-8-13/h3-11,16H,12H2,1-2H3,(H2,19,20) |
| InChIKey | GIEZCJILVJZFIV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|