C17H12F3N3O3 — CID 141165278
N-[8-methoxy-2-(trifluoromethyl)quinolin-5-yl]-1-oxidopyridin-1-ium-4-carboxamide (PubChem CID 141165278) has the molecular formula C17H12F3N3O3 and a molecular weight of 363.30 g/mol. Its IUPAC name is N-[8-methoxy-2-(trifluoromethyl)quinolin-5-yl]-1-oxidopyridin-1-ium-4-carboxamide.
| Compound Name | N-[8-methoxy-2-(trifluoromethyl)quinolin-5-yl]-1-oxidopyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 141165278 |
| Molecular Formula | C17H12F3N3O3 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | N-[8-methoxy-2-(trifluoromethyl)quinolin-5-yl]-1-oxidopyridin-1-ium-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc[n+]([O-])cc2)c2ccc(C(F)(F)F)nc12 |
| InChI | InChI=1S/C17H12F3N3O3/c1-26-13-4-3-12(21-16(24)10-6-8-23(25)9-7-10)11-2-5-14(17(18,19)20)22-15(11)13/h2-9H,1H3,(H,21,24) |
| InChIKey | WQFJIDQGDVSYIG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|