C14H11F3N2O3S — CID 143627567
2-[[8-methoxy-2-(trifluoromethyl)quinoline-5-carbothioyl]amino]acetic acid (PubChem CID 143627567) has the molecular formula C14H11F3N2O3S and a molecular weight of 344.31 g/mol. Its IUPAC name is 2-[[8-methoxy-2-(trifluoromethyl)quinoline-5-carbothioyl]amino]acetic acid.
| Compound Name | 2-[[8-methoxy-2-(trifluoromethyl)quinoline-5-carbothioyl]amino]acetic acid |
|---|---|
| PubChem CID | 143627567 |
| Molecular Formula | C14H11F3N2O3S |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 2-[[8-methoxy-2-(trifluoromethyl)quinoline-5-carbothioyl]amino]acetic acid |
| SMILES | COc1ccc(C(=S)NCC(=O)O)c2ccc(C(F)(F)F)nc12 |
| InChI | InChI=1S/C14H11F3N2O3S/c1-22-9-4-2-8(13(23)18-6-11(20)21)7-3-5-10(14(15,16)17)19-12(7)9/h2-5H,6H2,1H3,(H,18,23)(H,20,21) |
| InChIKey | IIYOEXGPJGDPMQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|