C17H18F3N3O2 — CID 143146723
methyl N-[(E)-4-aminobut-2-en-2-yl]-8-methoxy-2-(trifluoromethyl)quinoline-5-carboximidate (PubChem CID 143146723) has the molecular formula C17H18F3N3O2 and a molecular weight of 353.34 g/mol. Its IUPAC name is methyl N-[(E)-4-aminobut-2-en-2-yl]-8-methoxy-2-(trifluoromethyl)quinoline-5-carboximidate.
| Compound Name | methyl N-[(E)-4-aminobut-2-en-2-yl]-8-methoxy-2-(trifluoromethyl)quinoline-5-carboximidate |
|---|---|
| PubChem CID | 143146723 |
| Molecular Formula | C17H18F3N3O2 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | methyl N-[(E)-4-aminobut-2-en-2-yl]-8-methoxy-2-(trifluoromethyl)quinoline-5-carboximidate |
| SMILES | CO/C(=N\C(C)=C\CN)c1ccc(OC)c2nc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C17H18F3N3O2/c1-10(8-9-21)22-16(25-3)12-4-6-13(24-2)15-11(12)5-7-14(23-15)17(18,19)20/h4-8H,9,21H2,1-3H3/b10-8+,22-16- |
| InChIKey | ZLDPZCHIHWLEOL-JLFWXKHTSA-N |
| XLogP | 3.52 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|