C15H18F3NO — CID 143627563
ethane;5-ethyl-8-methoxy-2-(trifluoromethyl)quinoline (PubChem CID 143627563) has the molecular formula C15H18F3NO and a molecular weight of 285.31 g/mol. Its IUPAC name is ethane;5-ethyl-8-methoxy-2-(trifluoromethyl)quinoline.
| Compound Name | ethane;5-ethyl-8-methoxy-2-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 143627563 |
| Molecular Formula | C15H18F3NO |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | ethane;5-ethyl-8-methoxy-2-(trifluoromethyl)quinoline |
| SMILES | CC.CCc1ccc(OC)c2nc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C13H12F3NO.C2H6/c1-3-8-4-6-10(18-2)12-9(8)5-7-11(17-12)13(14,15)16;1-2/h4-7H,3H2,1-2H3;1-2H3 |
| InChIKey | SIDCACIEGHBUFE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |