C29H35F3N6O3 — CID 143146591
methyl N-[(E)-4-amino-1-[[2-(dipropylamino)-3-pyridinyl]methylamino]-1-oxobut-2-en-2-yl]-8-methoxy-2-(trifluoromethyl)quinoline-5-carboximidate (PubChem CID 143146591) has the molecular formula C29H35F3N6O3 and a molecular weight of 572.63 g/mol. Its IUPAC name is methyl N-[(E)-4-amino-1-[[2-(dipropylamino)-3-pyridinyl]methylamino]-1-oxobut-2-en-2-yl]-8-methoxy-2-(trifluoromethyl)quinoline-5-carboximidate.
| Compound Name | methyl N-[(E)-4-amino-1-[[2-(dipropylamino)-3-pyridinyl]methylamino]-1-oxobut-2-en-2-yl]-8-methoxy-2-(trifluoromethyl)quinoline-5-carboximidate |
|---|---|
| PubChem CID | 143146591 |
| Molecular Formula | C29H35F3N6O3 |
| Molecular Weight | 572.63 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | methyl N-[(E)-4-amino-1-[[2-(dipropylamino)-3-pyridinyl]methylamino]-1-oxobut-2-en-2-yl]-8-methoxy-2-(trifluoromethyl)quinoline-5-carboximidate |
| SMILES | CCCN(CCC)c1ncccc1CNC(=O)C(=C\CN)/N=C(\OC)c1ccc(OC)c2nc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C29H35F3N6O3/c1-5-16-38(17-6-2)26-19(8-7-15-34-26)18-35-27(39)22(13-14-33)36-28(41-4)21-9-11-23(40-3)25-20(21)10-12-24(37-25)29(30,31)32/h7-13,15H,5-6,14,16-18,33H2,1-4H3,(H,35,39)/b22-13+,36-28- |
| InChIKey | OZLABTWNFWQHAM-DQCVRXBVSA-N |
| XLogP | 4.84 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|