C26H23F3N4O4 — CID 70330034
3-aminoprop-1-en-2-yl N-[2-(1-benzofuran-2-ylmethylamino)-2-oxoethyl]-8-methoxy-2-(trifluoromethyl)quinoline-5-carboximidate (PubChem CID 70330034) has the molecular formula C26H23F3N4O4 and a molecular weight of 512.49 g/mol. Its IUPAC name is 3-aminoprop-1-en-2-yl N-[2-(1-benzofuran-2-ylmethylamino)-2-oxoethyl]-8-methoxy-2-(trifluoromethyl)quinoline-5-carboximidate.
| Compound Name | 3-aminoprop-1-en-2-yl N-[2-(1-benzofuran-2-ylmethylamino)-2-oxoethyl]-8-methoxy-2-(trifluoromethyl)quinoline-5-carboximidate |
|---|---|
| PubChem CID | 70330034 |
| Molecular Formula | C26H23F3N4O4 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 3-aminoprop-1-en-2-yl N-[2-(1-benzofuran-2-ylmethylamino)-2-oxoethyl]-8-methoxy-2-(trifluoromethyl)quinoline-5-carboximidate |
| SMILES | C=C(CN)O/C(=N\CC(=O)NCc1cc2ccccc2o1)c1ccc(OC)c2nc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C26H23F3N4O4/c1-15(12-30)36-25(32-14-23(34)31-13-17-11-16-5-3-4-6-20(16)37-17)19-7-9-21(35-2)24-18(19)8-10-22(33-24)26(27,28)29/h3-11H,1,12-14,30H2,2H3,(H,31,34)/b32-25- |
| InChIKey | SASRWHKVUNTUBO-MKCFTUBBSA-N |
| XLogP | 4.56 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|