C16H21F2N3 — CID 141166740
2-fluoro-4-(3-fluorophenyl)-1-[(4-methyl-2,5-dihydro-1H-imidazol-2-yl)methyl]piperidine (PubChem CID 141166740) has the molecular formula C16H21F2N3 and a molecular weight of 293.36 g/mol. Its IUPAC name is 2-fluoro-4-(3-fluorophenyl)-1-[(4-methyl-2,5-dihydro-1H-imidazol-2-yl)methyl]piperidine.
| Compound Name | 2-fluoro-4-(3-fluorophenyl)-1-[(4-methyl-2,5-dihydro-1H-imidazol-2-yl)methyl]piperidine |
|---|---|
| PubChem CID | 141166740 |
| Molecular Formula | C16H21F2N3 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-fluoro-4-(3-fluorophenyl)-1-[(4-methyl-2,5-dihydro-1H-imidazol-2-yl)methyl]piperidine |
| SMILES | CC1=NC(CN2CCC(c3cccc(F)c3)CC2F)NC1 |
| InChI | InChI=1S/C16H21F2N3/c1-11-9-19-16(20-11)10-21-6-5-13(8-15(21)18)12-3-2-4-14(17)7-12/h2-4,7,13,15-16,19H,5-6,8-10H2,1H3 |
| InChIKey | XFEPEFNHOUJFSP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|