C14H8N2OS — CID 141167613
7-oxido-2-phenylthieno[2,3-b]pyridin-7-ium-5-carbonitrile (PubChem CID 141167613) has the molecular formula C14H8N2OS and a molecular weight of 252.30 g/mol. Its IUPAC name is 7-oxido-2-phenylthieno[2,3-b]pyridin-7-ium-5-carbonitrile.
| Compound Name | 7-oxido-2-phenylthieno[2,3-b]pyridin-7-ium-5-carbonitrile |
|---|---|
| PubChem CID | 141167613 |
| Molecular Formula | C14H8N2OS |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 7-oxido-2-phenylthieno[2,3-b]pyridin-7-ium-5-carbonitrile |
| SMILES | N#Cc1cc2cc(-c3ccccc3)sc2[n+]([O-])c1 |
| InChI | InChI=1S/C14H8N2OS/c15-8-10-6-12-7-13(11-4-2-1-3-5-11)18-14(12)16(17)9-10/h1-7,9H |
| InChIKey | AVQODSMIRRNMPO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|