C9H5N3OS — CID 15394763
4-oxido-3-phenyl-1,2,4-thiadiazol-4-ium-5-carbonitrile (PubChem CID 15394763) has the molecular formula C9H5N3OS and a molecular weight of 203.23 g/mol. Its IUPAC name is 4-oxido-3-phenyl-1,2,4-thiadiazol-4-ium-5-carbonitrile.
| Compound Name | 4-oxido-3-phenyl-1,2,4-thiadiazol-4-ium-5-carbonitrile |
|---|---|
| PubChem CID | 15394763 |
| Molecular Formula | C9H5N3OS |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | 4-oxido-3-phenyl-1,2,4-thiadiazol-4-ium-5-carbonitrile |
| SMILES | N#Cc1snc(-c2ccccc2)[n+]1[O-] |
| InChI | InChI=1S/C9H5N3OS/c10-6-8-12(13)9(11-14-8)7-4-2-1-3-5-7/h1-5H |
| InChIKey | YRGZLRPWFMTCJZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 63.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|