C14H10N2OS — CID 23279319
2-oxido-3,4-diphenyl-1,2,5-thiadiazol-2-ium (PubChem CID 23279319) has the molecular formula C14H10N2OS and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-oxido-3,4-diphenyl-1,2,5-thiadiazol-2-ium.
| Compound Name | 2-oxido-3,4-diphenyl-1,2,5-thiadiazol-2-ium |
|---|---|
| PubChem CID | 23279319 |
| Molecular Formula | C14H10N2OS |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-oxido-3,4-diphenyl-1,2,5-thiadiazol-2-ium |
| SMILES | [O-][n+]1snc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C14H10N2OS/c17-16-14(12-9-5-2-6-10-12)13(15-18-16)11-7-3-1-4-8-11/h1-10H |
| InChIKey | COCIRWBJDVCXKG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 39.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|