C32H32N4O2S — CID 141167861
3-(benzenesulfonyl)-5-(4-benzylpiperazin-1-yl)-1-(4-ethylphenyl)indazole (PubChem CID 141167861) has the molecular formula C32H32N4O2S and a molecular weight of 536.70 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-5-(4-benzylpiperazin-1-yl)-1-(4-ethylphenyl)indazole.
| Compound Name | 3-(benzenesulfonyl)-5-(4-benzylpiperazin-1-yl)-1-(4-ethylphenyl)indazole |
|---|---|
| PubChem CID | 141167861 |
| Molecular Formula | C32H32N4O2S |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 3-(benzenesulfonyl)-5-(4-benzylpiperazin-1-yl)-1-(4-ethylphenyl)indazole |
| SMILES | CCc1ccc(-n2nc(S(=O)(=O)c3ccccc3)c3cc(N4CCN(Cc5ccccc5)CC4)ccc32)cc1 |
| InChI | InChI=1S/C32H32N4O2S/c1-2-25-13-15-27(16-14-25)36-31-18-17-28(35-21-19-34(20-22-35)24-26-9-5-3-6-10-26)23-30(31)32(33-36)39(37,38)29-11-7-4-8-12-29/h3-18,23H,2,19-22,24H2,1H3 |
| InChIKey | FMHPTYSTCUSHRL-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |