C44H30N4O10 — CID 141170015
1-[4-[4-[4-[2,4-bis(2,5-dioxopyrrol-1-yl)phenoxy]-3,5-dimethylphenyl]-2,6-dimethylphenoxy]-3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione (PubChem CID 141170015) has the molecular formula C44H30N4O10 and a molecular weight of 774.74 g/mol. Its IUPAC name is 1-[4-[4-[4-[2,4-bis(2,5-dioxopyrrol-1-yl)phenoxy]-3,5-dimethylphenyl]-2,6-dimethylphenoxy]-3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[4-[4-[2,4-bis(2,5-dioxopyrrol-1-yl)phenoxy]-3,5-dimethylphenyl]-2,6-dimethylphenoxy]-3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 141170015 |
| Molecular Formula | C44H30N4O10 |
| Molecular Weight | 774.74 g/mol |
| Exact Mass | 774.20 |
| IUPAC Name | 1-[4-[4-[4-[2,4-bis(2,5-dioxopyrrol-1-yl)phenoxy]-3,5-dimethylphenyl]-2,6-dimethylphenoxy]-3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione |
| SMILES | Cc1cc(-c2cc(C)c(Oc3ccc(N4C(=O)C=CC4=O)cc3N3C(=O)C=CC3=O)c(C)c2)cc(C)c1Oc1ccc(N2C(=O)C=CC2=O)cc1N1C(=O)C=CC1=O |
| InChI | InChI=1S/C44H30N4O10/c1-23-17-27(18-24(2)43(23)57-33-7-5-29(45-35(49)9-10-36(45)50)21-31(33)47-39(53)13-14-40(47)54)28-19-25(3)44(26(4)20-28)58-34-8-6-30(46-37(51)11-12-38(46)52)22-32(34)48-41(55)15-16-42(48)56/h5-22H,1-4H3 |
| InChIKey | GSBKFCXCBAINBY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 167.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.74 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|