C15H24N2O4S — CID 141173908
2-(1,1-dioxo-1,2,5-thiadiazolidin-2-yl)-4-(5-hydroxy-5-methylhexyl)phenol (PubChem CID 141173908) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,2,5-thiadiazolidin-2-yl)-4-(5-hydroxy-5-methylhexyl)phenol.
| Compound Name | 2-(1,1-dioxo-1,2,5-thiadiazolidin-2-yl)-4-(5-hydroxy-5-methylhexyl)phenol |
|---|---|
| PubChem CID | 141173908 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-(1,1-dioxo-1,2,5-thiadiazolidin-2-yl)-4-(5-hydroxy-5-methylhexyl)phenol |
| SMILES | CC(C)(O)CCCCc1ccc(O)c(N2CCNS2(=O)=O)c1 |
| InChI | InChI=1S/C15H24N2O4S/c1-15(2,19)8-4-3-5-12-6-7-14(18)13(11-12)17-10-9-16-22(17,20)21/h6-7,11,16,18-19H,3-5,8-10H2,1-2H3 |
| InChIKey | WTVMLQMNVKBIDE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|