C10H18O5S — CID 141174527
(2,2-dimethyl-3-propoxycarbonylcyclopropyl)methanesulfonic acid (PubChem CID 141174527) has the molecular formula C10H18O5S and a molecular weight of 250.32 g/mol. Its IUPAC name is (2,2-dimethyl-3-propoxycarbonylcyclopropyl)methanesulfonic acid.
| Compound Name | (2,2-dimethyl-3-propoxycarbonylcyclopropyl)methanesulfonic acid |
|---|---|
| PubChem CID | 141174527 |
| Molecular Formula | C10H18O5S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | (2,2-dimethyl-3-propoxycarbonylcyclopropyl)methanesulfonic acid |
| SMILES | CCCOC(=O)C1C(CS(=O)(=O)O)C1(C)C |
| InChI | InChI=1S/C10H18O5S/c1-4-5-15-9(11)8-7(10(8,2)3)6-16(12,13)14/h7-8H,4-6H2,1-3H3,(H,12,13,14) |
| InChIKey | VTHOYPUVKSUGQW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|