C10H17NaO6S — CID 87423757
sodium (2,2-dimethyl-3-propoxycarbonylcyclopropyl)-hydroxymethanesulfonate (PubChem CID 87423757) has the molecular formula C10H17NaO6S and a molecular weight of 288.30 g/mol. Its IUPAC name is sodium (2,2-dimethyl-3-propoxycarbonylcyclopropyl)-hydroxymethanesulfonate.
| Compound Name | sodium (2,2-dimethyl-3-propoxycarbonylcyclopropyl)-hydroxymethanesulfonate |
|---|---|
| PubChem CID | 87423757 |
| Molecular Formula | C10H17NaO6S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | sodium (2,2-dimethyl-3-propoxycarbonylcyclopropyl)-hydroxymethanesulfonate |
| SMILES | CCCOC(=O)C1C(C(O)S(=O)(=O)[O-])C1(C)C.[Na+] |
| InChI | InChI=1S/C10H18O6S.Na/c1-4-5-16-8(11)6-7(10(6,2)3)9(12)17(13,14)15;/h6-7,9,12H,4-5H2,1-3H3,(H,13,14,15);/q;+1/p-1 |
| InChIKey | REPPKMRITJFJJE-UHFFFAOYSA-M |
| XLogP | -2.92 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|