About sodium [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]-hydroxymethanesulfonate
sodium [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]-hydroxymethanesulfonate (PubChem CID 87423595) has the molecular formula C11H19NaO6S
and a molecular weight of 302.32 g/mol. Its IUPAC name is sodium [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]-hydroxymethanesulfonate.
Molecular Properties
| Compound Name | sodium [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]-hydroxymethanesulfonate |
| PubChem CID | 87423595 |
| Molecular Formula | C11H19NaO6S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | sodium [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]-hydroxymethanesulfonate |
| SMILES | CC(C)(C)OC(=O)C1C(C(O)S(=O)(=O)[O-])C1(C)C.[Na+] |
| InChI | InChI=1S/C11H20O6S.Na/c1-10(2,3)17-8(12)6-7(11(6,4)5)9(13)18(14,15)16;/h6-7,9,13H,1-5H3,(H,14,15,16);/q;+1/p-1 |
| InChIKey | DVGBHWKJGAEKFH-UHFFFAOYSA-M |
| XLogP | -2.53 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]-hydroxymethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]-hydroxymethanesulfonate?
The IUPAC name of sodium [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]-hydroxymethanesulfonate (CID 87423595) is sodium [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]-hydroxymethanesulfonate.
What is the SMILES notation for sodium [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]-hydroxymethanesulfonate?
The canonical SMILES for sodium [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]-hydroxymethanesulfonate is CC(C)(C)OC(=O)C1C(C(O)S(=O)(=O)[O-])C1(C)C.[Na+].
What is the InChIKey of sodium [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]-hydroxymethanesulfonate?
The InChIKey is DVGBHWKJGAEKFH-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H20O6S.Na/c1-10(2,3)17-8(12)6-7(11(6,4)5)9(13)18(14,15)16;/h6-7,9,13H,1-5H3,(H,14,15,16);/q;+1/p-1.
What are the key properties of sodium [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]-hydroxymethanesulfonate?
sodium [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]-hydroxymethanesulfonate has a molecular weight of 302.32 g/mol, XLogP of -2.53, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]-hydroxymethanesulfonate is sourced from PubChem (CID 87423595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).