C24H19NO4 — CID 141175343
2,3-bis(4-hydroxyphenyl)-4-methoxynaphthalene-1-carboxamide (PubChem CID 141175343) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2,3-bis(4-hydroxyphenyl)-4-methoxynaphthalene-1-carboxamide.
| Compound Name | 2,3-bis(4-hydroxyphenyl)-4-methoxynaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 141175343 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2,3-bis(4-hydroxyphenyl)-4-methoxynaphthalene-1-carboxamide |
| SMILES | COc1c(-c2ccc(O)cc2)c(-c2ccc(O)cc2)c(C(N)=O)c2ccccc12 |
| InChI | InChI=1S/C24H19NO4/c1-29-23-19-5-3-2-4-18(19)22(24(25)28)20(14-6-10-16(26)11-7-14)21(23)15-8-12-17(27)13-9-15/h2-13,26-27H,1H3,(H2,25,28) |
| InChIKey | JPJGQLFNOPPGKJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |