C14H18O6S — CID 141175379
2-[2-(2-sulfooxypropan-2-yl)phenyl]ethyl prop-2-enoate (PubChem CID 141175379) has the molecular formula C14H18O6S and a molecular weight of 314.36 g/mol. Its IUPAC name is 2-[2-(2-sulfooxypropan-2-yl)phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[2-(2-sulfooxypropan-2-yl)phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 141175379 |
| Molecular Formula | C14H18O6S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-[2-(2-sulfooxypropan-2-yl)phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccccc1C(C)(C)OS(=O)(=O)O |
| InChI | InChI=1S/C14H18O6S/c1-4-13(15)19-10-9-11-7-5-6-8-12(11)14(2,3)20-21(16,17)18/h4-8H,1,9-10H2,2-3H3,(H,16,17,18) |
| InChIKey | DMZMEQOMUBJTSQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|