C14H21NO6S — CID 67537228
2-[2-(2-aminopropan-2-yl)phenyl]ethyl prop-2-enoate;sulfuric acid (PubChem CID 67537228) has the molecular formula C14H21NO6S and a molecular weight of 331.39 g/mol. Its IUPAC name is 2-[2-(2-aminopropan-2-yl)phenyl]ethyl prop-2-enoate;sulfuric acid.
| Compound Name | 2-[2-(2-aminopropan-2-yl)phenyl]ethyl prop-2-enoate;sulfuric acid |
|---|---|
| PubChem CID | 67537228 |
| Molecular Formula | C14H21NO6S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-[2-(2-aminopropan-2-yl)phenyl]ethyl prop-2-enoate;sulfuric acid |
| SMILES | C=CC(=O)OCCc1ccccc1C(C)(C)N.O=S(=O)(O)O |
| InChI | InChI=1S/C14H19NO2.H2O4S/c1-4-13(16)17-10-9-11-7-5-6-8-12(11)14(2,3)15;1-5(2,3)4/h4-8H,1,9-10,15H2,2-3H3;(H2,1,2,3,4) |
| InChIKey | PSZATLMUYRZLKI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|