About 2-[2-(2-aminopropan-2-yl)phenyl]ethyl prop-2-enoate;hydroiodide
2-[2-(2-aminopropan-2-yl)phenyl]ethyl prop-2-enoate;hydroiodide (PubChem CID 173064353) has the molecular formula C14H20INO2
and a molecular weight of 361.22 g/mol. Its IUPAC name is 2-[2-(2-aminopropan-2-yl)phenyl]ethyl prop-2-enoate;hydroiodide.
Molecular Properties
| Compound Name | 2-[2-(2-aminopropan-2-yl)phenyl]ethyl prop-2-enoate;hydroiodide |
| PubChem CID | 173064353 |
| Molecular Formula | C14H20INO2 |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 2-[2-(2-aminopropan-2-yl)phenyl]ethyl prop-2-enoate;hydroiodide |
| SMILES | C=CC(=O)OCCc1ccccc1C(C)(C)N.I |
| InChI | InChI=1S/C14H19NO2.HI/c1-4-13(16)17-10-9-11-7-5-6-8-12(11)14(2,3)15;/h4-8H,1,9-10,15H2,2-3H3;1H |
| InChIKey | FOFLIJRFSMWFQP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-aminopropan-2-yl)phenyl]ethyl prop-2-enoate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-aminopropan-2-yl)phenyl]ethyl prop-2-enoate;hydroiodide?
The IUPAC name of 2-[2-(2-aminopropan-2-yl)phenyl]ethyl prop-2-enoate;hydroiodide (CID 173064353) is 2-[2-(2-aminopropan-2-yl)phenyl]ethyl prop-2-enoate;hydroiodide.
What is the SMILES notation for 2-[2-(2-aminopropan-2-yl)phenyl]ethyl prop-2-enoate;hydroiodide?
The canonical SMILES for 2-[2-(2-aminopropan-2-yl)phenyl]ethyl prop-2-enoate;hydroiodide is C=CC(=O)OCCc1ccccc1C(C)(C)N.I.
What is the InChIKey of 2-[2-(2-aminopropan-2-yl)phenyl]ethyl prop-2-enoate;hydroiodide?
The InChIKey is FOFLIJRFSMWFQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2.HI/c1-4-13(16)17-10-9-11-7-5-6-8-12(11)14(2,3)15;/h4-8H,1,9-10,15H2,2-3H3;1H.
What are the key properties of 2-[2-(2-aminopropan-2-yl)phenyl]ethyl prop-2-enoate;hydroiodide?
2-[2-(2-aminopropan-2-yl)phenyl]ethyl prop-2-enoate;hydroiodide has a molecular weight of 361.22 g/mol, XLogP of 2.77, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-aminopropan-2-yl)phenyl]ethyl prop-2-enoate;hydroiodide is sourced from PubChem (CID 173064353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).