C10H23NO5Si — CID 141175457
2-methyl-3-[propyl(trimethoxysilyl)amino]propanoic acid (PubChem CID 141175457) has the molecular formula C10H23NO5Si and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-methyl-3-[propyl(trimethoxysilyl)amino]propanoic acid.
| Compound Name | 2-methyl-3-[propyl(trimethoxysilyl)amino]propanoic acid |
|---|---|
| PubChem CID | 141175457 |
| Molecular Formula | C10H23NO5Si |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2-methyl-3-[propyl(trimethoxysilyl)amino]propanoic acid |
| SMILES | CCCN(CC(C)C(=O)O)[Si](OC)(OC)OC |
| InChI | InChI=1S/C10H23NO5Si/c1-6-7-11(8-9(2)10(12)13)17(14-3,15-4)16-5/h9H,6-8H2,1-5H3,(H,12,13) |
| InChIKey | NCSBLOMCHZIRDV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|