C12H8ClN3O4 — CID 141175778
1-[2-[(E)-2-carboxyethenyl]-4-chlorophenyl]triazole-4-carboxylic acid (PubChem CID 141175778) has the molecular formula C12H8ClN3O4 and a molecular weight of 293.67 g/mol. Its IUPAC name is 1-[2-[(E)-2-carboxyethenyl]-4-chlorophenyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[(E)-2-carboxyethenyl]-4-chlorophenyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 141175778 |
| Molecular Formula | C12H8ClN3O4 |
| Molecular Weight | 293.67 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 1-[2-[(E)-2-carboxyethenyl]-4-chlorophenyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)/C=C/c1cc(Cl)ccc1-n1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C12H8ClN3O4/c13-8-2-3-10(7(5-8)1-4-11(17)18)16-6-9(12(19)20)14-15-16/h1-6H,(H,17,18)(H,19,20)/b4-1+ |
| InChIKey | QNQCEVAJKXPMDC-DAFODLJHSA-N |
| XLogP | 1.72 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.67 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|