C28H19N5O2S — CID 141175830
2-[5-(6-methoxy-3-pyridinyl)-4-(1-methylbenzimidazol-2-yl)-1,3-benzothiazol-2-yl]-1,3-benzoxazole (PubChem CID 141175830) has the molecular formula C28H19N5O2S and a molecular weight of 489.56 g/mol. Its IUPAC name is 2-[5-(6-methoxy-3-pyridinyl)-4-(1-methylbenzimidazol-2-yl)-1,3-benzothiazol-2-yl]-1,3-benzoxazole.
| Compound Name | 2-[5-(6-methoxy-3-pyridinyl)-4-(1-methylbenzimidazol-2-yl)-1,3-benzothiazol-2-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 141175830 |
| Molecular Formula | C28H19N5O2S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 2-[5-(6-methoxy-3-pyridinyl)-4-(1-methylbenzimidazol-2-yl)-1,3-benzothiazol-2-yl]-1,3-benzoxazole |
| SMILES | COc1ccc(-c2ccc3sc(-c4nc5ccccc5o4)nc3c2-c2nc3ccccc3n2C)cn1 |
| InChI | InChI=1S/C28H19N5O2S/c1-33-20-9-5-3-7-18(20)30-26(33)24-17(16-11-14-23(34-2)29-15-16)12-13-22-25(24)32-28(36-22)27-31-19-8-4-6-10-21(19)35-27/h3-15H,1-2H3 |
| InChIKey | QPMGEJMZECDIJN-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 78.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|