C15H16N4O4S — CID 141175980
O-ethyl 4-(4-methoxy-2-nitroanilino)-2-methylpyrimidine-5-carbothioate (PubChem CID 141175980) has the molecular formula C15H16N4O4S and a molecular weight of 348.38 g/mol. Its IUPAC name is O-ethyl 4-(4-methoxy-2-nitroanilino)-2-methylpyrimidine-5-carbothioate.
| Compound Name | O-ethyl 4-(4-methoxy-2-nitroanilino)-2-methylpyrimidine-5-carbothioate |
|---|---|
| PubChem CID | 141175980 |
| Molecular Formula | C15H16N4O4S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | O-ethyl 4-(4-methoxy-2-nitroanilino)-2-methylpyrimidine-5-carbothioate |
| SMILES | CCOC(=S)c1cnc(C)nc1Nc1ccc(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16N4O4S/c1-4-23-15(24)11-8-16-9(2)17-14(11)18-12-6-5-10(22-3)7-13(12)19(20)21/h5-8H,4H2,1-3H3,(H,16,17,18) |
| InChIKey | BQJYDGCKYWFIPE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|