sodium 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate

C16H9ClNNaO2S — CID 141176189

IUPACsodium 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate
SMILESO=C([O-])C1=CC(c2ccc(Cl)cc2)=Nc2ccccc2S1.[Na+]
InChIInChI=1S/C16H10ClNO2S.Na/c17-11-7-5-10(6-8-11)13-9-15(16(19)20)21-14-4-2-1-3-12(14)18-13;/h1-9H,(H,19,20);/q;+1/p-1
InChIKeyDTTNPTOEMXOKJQ-UHFFFAOYSA-M
MW337.76 g/mol
LogP0.20
Rot. Bonds2

About sodium 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate

sodium 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate (PubChem CID 141176189) has the molecular formula C16H9ClNNaO2S and a molecular weight of 337.76 g/mol. Its IUPAC name is sodium 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate.

Molecular Properties

Compound Namesodium 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate
PubChem CID141176189
Molecular FormulaC16H9ClNNaO2S
Molecular Weight337.76 g/mol
Exact Mass336.99
IUPAC Namesodium 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate
SMILESO=C([O-])C1=CC(c2ccc(Cl)cc2)=Nc2ccccc2S1.[Na+]
InChIInChI=1S/C16H10ClNO2S.Na/c17-11-7-5-10(6-8-11)13-9-15(16(19)20)21-14-4-2-1-3-12(14)18-13;/h1-9H,(H,19,20);/q;+1/p-1
InChIKeyDTTNPTOEMXOKJQ-UHFFFAOYSA-M
XLogP0.20
TPSA52.49 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500337.76
LogP ≤ 50.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze sodium 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate?
The IUPAC name of sodium 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate (CID 141176189) is sodium 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate.
What is the SMILES notation for sodium 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate?
The canonical SMILES for sodium 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate is O=C([O-])C1=CC(c2ccc(Cl)cc2)=Nc2ccccc2S1.[Na+].
What is the InChIKey of sodium 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate?
The InChIKey is DTTNPTOEMXOKJQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H10ClNO2S.Na/c17-11-7-5-10(6-8-11)13-9-15(16(19)20)21-14-4-2-1-3-12(14)18-13;/h1-9H,(H,19,20);/q;+1/p-1.
What are the key properties of sodium 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate?
sodium 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate has a molecular weight of 337.76 g/mol, XLogP of 0.20, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate is sourced from PubChem (CID 141176189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).