C9H10O4 — CID 141178076
4,5-dimethoxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carbaldehyde (PubChem CID 141178076) has the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. Its IUPAC name is 4,5-dimethoxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carbaldehyde.
| Compound Name | 4,5-dimethoxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 141178076 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 4,5-dimethoxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carbaldehyde |
| SMILES | COC1=C(OC)C2OC2(C=O)C=C1 |
| InChI | InChI=1S/C9H10O4/c1-11-6-3-4-9(5-10)8(13-9)7(6)12-2/h3-5,8H,1-2H3 |
| InChIKey | KKFAQEOWXMAMEQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|