C8H6O4 — CID 141198289
6aH-oxireno[2,3-g][1,3]benzodioxole-5a-carbaldehyde (PubChem CID 141198289) has the molecular formula C8H6O4 and a molecular weight of 166.13 g/mol. Its IUPAC name is 6aH-oxireno[2,3-g][1,3]benzodioxole-5a-carbaldehyde.
| Compound Name | 6aH-oxireno[2,3-g][1,3]benzodioxole-5a-carbaldehyde |
|---|---|
| PubChem CID | 141198289 |
| Molecular Formula | C8H6O4 |
| Molecular Weight | 166.13 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 6aH-oxireno[2,3-g][1,3]benzodioxole-5a-carbaldehyde |
| SMILES | O=CC12C=CC3=C(OCO3)C1O2 |
| InChI | InChI=1S/C8H6O4/c9-3-8-2-1-5-6(7(8)12-8)11-4-10-5/h1-3,7H,4H2 |
| InChIKey | SCDPFHZJZKMWOY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.13 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|