C8H6O5 — CID 141399872
6aH-oxireno[2,3-g][1,3]benzodioxole-5a-carboxylic acid (PubChem CID 141399872) has the molecular formula C8H6O5 and a molecular weight of 182.13 g/mol. Its IUPAC name is 6aH-oxireno[2,3-g][1,3]benzodioxole-5a-carboxylic acid.
| Compound Name | 6aH-oxireno[2,3-g][1,3]benzodioxole-5a-carboxylic acid |
|---|---|
| PubChem CID | 141399872 |
| Molecular Formula | C8H6O5 |
| Molecular Weight | 182.13 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 6aH-oxireno[2,3-g][1,3]benzodioxole-5a-carboxylic acid |
| SMILES | O=C(O)C12C=CC3=C(OCO3)C1O2 |
| InChI | InChI=1S/C8H6O5/c9-7(10)8-2-1-4-5(6(8)13-8)12-3-11-4/h1-2,6H,3H2,(H,9,10) |
| InChIKey | AWERYPAPPRYKMZ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.13 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|