C10H12O6 — CID 141167035
4,5,6-trimethoxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid (PubChem CID 141167035) has the molecular formula C10H12O6 and a molecular weight of 228.20 g/mol. Its IUPAC name is 4,5,6-trimethoxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid.
| Compound Name | 4,5,6-trimethoxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 141167035 |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 4,5,6-trimethoxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid |
| SMILES | COC1=C(OC)C2(OC)OC2(C(=O)O)C=C1 |
| InChI | InChI=1S/C10H12O6/c1-13-6-4-5-9(8(11)12)10(15-3,16-9)7(6)14-2/h4-5H,1-3H3,(H,11,12) |
| InChIKey | IMOJWFUSSBJMBU-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|