1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid

C10H12O6 — CID 71279376

IUPAC1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid
SMILESCOC1=CC=CC(C(=O)O)C1(OC)C(=O)O
InChIInChI=1S/C10H12O6/c1-15-7-5-3-4-6(8(11)12)10(7,16-2)9(13)14/h3-6H,1-2H3,(H,11,12)(H,13,14)
InChIKeyRDENGCQDCXUWCJ-UHFFFAOYSA-N
MW228.20 g/mol
LogP0.26
Rot. Bonds4

About 1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid

1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid (PubChem CID 71279376) has the molecular formula C10H12O6 and a molecular weight of 228.20 g/mol. Its IUPAC name is 1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid.

Molecular Properties

Compound Name1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid
PubChem CID71279376
Molecular FormulaC10H12O6
Molecular Weight228.20 g/mol
Exact Mass228.06
IUPAC Name1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid
SMILESCOC1=CC=CC(C(=O)O)C1(OC)C(=O)O
InChIInChI=1S/C10H12O6/c1-15-7-5-3-4-6(8(11)12)10(7,16-2)9(13)14/h3-6H,1-2H3,(H,11,12)(H,13,14)
InChIKeyRDENGCQDCXUWCJ-UHFFFAOYSA-N
XLogP0.26
TPSA93.06 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.20
LogP ≤ 50.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid?
The IUPAC name of 1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid (CID 71279376) is 1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid.
What is the SMILES notation for 1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid?
The canonical SMILES for 1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid is COC1=CC=CC(C(=O)O)C1(OC)C(=O)O.
What is the InChIKey of 1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid?
The InChIKey is RDENGCQDCXUWCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O6/c1-15-7-5-3-4-6(8(11)12)10(7,16-2)9(13)14/h3-6H,1-2H3,(H,11,12)(H,13,14).
What are the key properties of 1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid?
1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid has a molecular weight of 228.20 g/mol, XLogP of 0.26, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid is sourced from PubChem (CID 71279376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).