C10H12O6 — CID 71279376
1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid (PubChem CID 71279376) has the molecular formula C10H12O6 and a molecular weight of 228.20 g/mol. Its IUPAC name is 1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid.
| Compound Name | 1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 71279376 |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 1,6-dimethoxycyclohexa-3,5-diene-1,2-dicarboxylic acid |
| SMILES | COC1=CC=CC(C(=O)O)C1(OC)C(=O)O |
| InChI | InChI=1S/C10H12O6/c1-15-7-5-3-4-6(8(11)12)10(7,16-2)9(13)14/h3-6H,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | RDENGCQDCXUWCJ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |