C8H8O5 — CID 176906376
4-hydroxy-5-methoxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid (PubChem CID 176906376) has the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. Its IUPAC name is 4-hydroxy-5-methoxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid.
| Compound Name | 4-hydroxy-5-methoxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 176906376 |
| Molecular Formula | C8H8O5 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 4-hydroxy-5-methoxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid |
| SMILES | COC1=C(O)C=CC2(C(=O)O)OC12 |
| InChI | InChI=1S/C8H8O5/c1-12-5-4(9)2-3-8(7(10)11)6(5)13-8/h2-3,6,9H,1H3,(H,10,11) |
| InChIKey | PGHWMDHLIDJMAQ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|